C32H34BrN3O7 — CID 126411853
ethyl (2R)-2-[5-bromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]propanoate (PubChem CID 126411853) has the molecular formula C32H34BrN3O7 and a molecular weight of 652.54 g/mol. Its IUPAC name is ethyl (2R)-2-[5-bromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[5-bromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 126411853 |
| Molecular Formula | C32H34BrN3O7 |
| Molecular Weight | 652.54 g/mol |
| Exact Mass | 651.16 |
| IUPAC Name | ethyl (2R)-2-[5-bromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1cc(Br)c(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc1OCC |
| InChI | InChI=1S/C32H34BrN3O7/c1-6-39-29-16-23(27(33)17-30(29)42-22(5)32(38)40-7-2)18-34-35-31(37)28-15-14-26(43-28)19-41-25-12-10-24(11-13-25)36-20(3)8-9-21(36)4/h8-18,22H,6-7,19H2,1-5H3,(H,35,37)/b34-18+/t22-/m1/s1 |
| InChIKey | ZVBVYDGRLKZKRX-OYBXHTDESA-N |
| XLogP | 6.52 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|