C29H27Br2N3O6 — CID 126409553
[2,3-dibromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenyl] acetate (PubChem CID 126409553) has the molecular formula C29H27Br2N3O6 and a molecular weight of 673.36 g/mol. Its IUPAC name is [2,3-dibromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenyl] acetate.
| Compound Name | [2,3-dibromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenyl] acetate |
|---|---|
| PubChem CID | 126409553 |
| Molecular Formula | C29H27Br2N3O6 |
| Molecular Weight | 673.36 g/mol |
| Exact Mass | 671.03 |
| IUPAC Name | [2,3-dibromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenyl] acetate |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c(Br)c(Br)c1OC(C)=O |
| InChI | InChI=1S/C29H27Br2N3O6/c1-5-37-25-14-20(26(30)27(31)28(25)39-19(4)35)15-32-33-29(36)24-13-12-23(40-24)16-38-22-10-8-21(9-11-22)34-17(2)6-7-18(34)3/h6-15H,5,16H2,1-4H3,(H,33,36)/b32-15+ |
| InChIKey | SCSHCHXAACTMQZ-VWJSQJICSA-N |
| XLogP | 6.88 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.36 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|