C31H34BrN3O5 — CID 126404603
N-[(E)-[2-bromo-5-ethoxy-4-[(2-methylpropan-2-yl)oxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126404603) has the molecular formula C31H34BrN3O5 and a molecular weight of 608.53 g/mol. Its IUPAC name is N-[(E)-[2-bromo-5-ethoxy-4-[(2-methylpropan-2-yl)oxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[2-bromo-5-ethoxy-4-[(2-methylpropan-2-yl)oxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126404603 |
| Molecular Formula | C31H34BrN3O5 |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 607.17 |
| IUPAC Name | N-[(E)-[2-bromo-5-ethoxy-4-[(2-methylpropan-2-yl)oxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c(Br)cc1OC(C)(C)C |
| InChI | InChI=1S/C31H34BrN3O5/c1-7-37-28-16-22(26(32)17-29(28)40-31(4,5)6)18-33-34-30(36)27-15-14-25(39-27)19-38-24-12-10-23(11-13-24)35-20(2)8-9-21(35)3/h8-18H,7,19H2,1-6H3,(H,34,36)/b33-18+ |
| InChIKey | BEGWKBMFJXMGBJ-DPNNOFEESA-N |
| XLogP | 7.37 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|