C32H35N3O7 — CID 126410146
ethyl (2S)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]propanoate (PubChem CID 126410146) has the molecular formula C32H35N3O7 and a molecular weight of 573.65 g/mol. Its IUPAC name is ethyl (2S)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]propanoate.
| Compound Name | ethyl (2S)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 126410146 |
| Molecular Formula | C32H35N3O7 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | ethyl (2S)-2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]propanoate |
| SMILES | CCOC(=O)[C@H](C)Oc1ccc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc1OCC |
| InChI | InChI=1S/C32H35N3O7/c1-6-38-30-18-24(10-16-28(30)41-23(5)32(37)39-7-2)19-33-34-31(36)29-17-15-27(42-29)20-40-26-13-11-25(12-14-26)35-21(3)8-9-22(35)4/h8-19,23H,6-7,20H2,1-5H3,(H,34,36)/b33-19+/t23-/m0/s1 |
| InChIKey | UWGPDKFVJZJBIY-LZNCRMCUSA-N |
| XLogP | 5.76 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|