C30H24BrN5O6 — CID 126404921
N-[(E)-[5-bromo-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126404921) has the molecular formula C30H24BrN5O6 and a molecular weight of 630.46 g/mol. Its IUPAC name is N-[(E)-[5-bromo-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[5-bromo-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126404921 |
| Molecular Formula | C30H24BrN5O6 |
| Molecular Weight | 630.46 g/mol |
| Exact Mass | 629.09 |
| IUPAC Name | N-[(E)-[5-bromo-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(Br)ccc3Oc3ccc([N+](=O)[O-])cn3)o2)cc1 |
| InChI | InChI=1S/C30H24BrN5O6/c1-19-3-4-20(2)35(19)23-6-9-25(10-7-23)40-18-26-11-13-28(41-26)30(37)34-33-16-21-15-22(31)5-12-27(21)42-29-14-8-24(17-32-29)36(38)39/h3-17H,18H2,1-2H3,(H,34,37)/b33-16+ |
| InChIKey | COSLBQXTJHCBSY-MHDJOFBISA-N |
| XLogP | 6.89 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.46 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|