C34H28N4O7 — CID 126410708
[2-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 126410708) has the molecular formula C34H28N4O7 and a molecular weight of 604.62 g/mol. Its IUPAC name is [2-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126410708 |
| Molecular Formula | C34H28N4O7 |
| Molecular Weight | 604.62 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | [2-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C\c3ccccc3OC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)o2)cc1 |
| InChI | InChI=1S/C34H28N4O7/c1-23-7-8-24(2)37(23)27-14-16-29(17-15-27)43-22-30-18-19-32(44-30)34(40)36-35-21-26-5-3-4-6-31(26)45-33(39)20-11-25-9-12-28(13-10-25)38(41)42/h3-21H,22H2,1-2H3,(H,36,40)/b20-11+,35-21- |
| InChIKey | BHVSADGTZJXYKH-GVQYYXSUSA-N |
| XLogP | 6.56 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.62 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|