C36H33Cl2N3O5 — CID 126408763
N-[(E)-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126408763) has the molecular formula C36H33Cl2N3O5 and a molecular weight of 658.58 g/mol. Its IUPAC name is N-[(E)-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126408763 |
| Molecular Formula | C36H33Cl2N3O5 |
| Molecular Weight | 658.58 g/mol |
| Exact Mass | 657.18 |
| IUPAC Name | N-[(E)-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | C=CCc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(OC)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C36H33Cl2N3O5/c1-5-6-27-17-26(19-34(43-4)35(27)45-21-25-9-15-31(37)32(38)18-25)20-39-40-36(42)33-16-14-30(46-33)22-44-29-12-10-28(11-13-29)41-23(2)7-8-24(41)3/h5,7-20H,1,6,21-22H2,2-4H3,(H,40,42)/b39-20+ |
| InChIKey | PSCLZBISGOMIJP-JOXMEQDKSA-N |
| XLogP | 8.65 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.58 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|