C32H35N3O5 — CID 126407890
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-(3-methoxy-4-propan-2-yloxy-5-prop-2-enylphenyl)methylideneamino]furan-2-carboxamide (PubChem CID 126407890) has the molecular formula C32H35N3O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-(3-methoxy-4-propan-2-yloxy-5-prop-2-enylphenyl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-(3-methoxy-4-propan-2-yloxy-5-prop-2-enylphenyl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126407890 |
| Molecular Formula | C32H35N3O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-(3-methoxy-4-propan-2-yloxy-5-prop-2-enylphenyl)methylideneamino]furan-2-carboxamide |
| SMILES | C=CCc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(OC)c1OC(C)C |
| InChI | InChI=1S/C32H35N3O5/c1-7-8-25-17-24(18-30(37-6)31(25)39-21(2)3)19-33-34-32(36)29-16-15-28(40-29)20-38-27-13-11-26(12-14-27)35-22(4)9-10-23(35)5/h7,9-19,21H,1,8,20H2,2-6H3,(H,34,36)/b33-19+ |
| InChIKey | MQRVCXZYQTUWDJ-HNSNBQBZSA-N |
| XLogP | 6.55 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|