C20H18N2O6S — CID 5221643
5-[[2-ethoxy-4-[(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 5221643) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is 5-[[2-ethoxy-4-[(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-ethoxy-4-[(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 5221643 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 5-[[2-ethoxy-4-[(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | CCOc1cc(C=NNC(=O)c2cccs2)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C20H18N2O6S/c1-2-26-17-10-13(11-21-22-19(23)18-4-3-9-29-18)5-7-15(17)27-12-14-6-8-16(28-14)20(24)25/h3-11H,2,12H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | INMFNQDJHYFGLY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|