C18H22N3O4+ — CID 9058604
[2-methoxy-4-[(Z)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]phenyl] furan-2-carboxylate (PubChem CID 9058604) has the molecular formula C18H22N3O4+ and a molecular weight of 344.39 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-methoxy-4-[(Z)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 9058604 |
| Molecular Formula | C18H22N3O4+ |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [2-methoxy-4-[(Z)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]phenyl] furan-2-carboxylate |
| SMILES | COc1cc(/C=N\N2CC[NH+](C)CC2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C18H21N3O4/c1-20-7-9-21(10-8-20)19-13-14-5-6-15(17(12-14)23-2)25-18(22)16-4-3-11-24-16/h3-6,11-13H,7-10H2,1-2H3/p+1/b19-13- |
| InChIKey | GXSXRNFMYUVTJD-UYRXBGFRSA-O |
| XLogP | 0.67 |
| TPSA | 68.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|