C14H22N3O3+ — CID 135852429
2,6-dimethoxy-4-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]phenol (PubChem CID 135852429) has the molecular formula C14H22N3O3+ and a molecular weight of 280.35 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]phenol.
| Compound Name | 2,6-dimethoxy-4-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135852429 |
| Molecular Formula | C14H22N3O3+ |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2,6-dimethoxy-4-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]phenol |
| SMILES | COc1cc(/C=N/N2CC[NH+](C)CC2)cc(OC)c1O |
| InChI | InChI=1S/C14H21N3O3/c1-16-4-6-17(7-5-16)15-10-11-8-12(19-2)14(18)13(9-11)20-3/h8-10,18H,4-7H2,1-3H3/p+1/b15-10+ |
| InChIKey | JRKFKBNSTDCVIV-XNTDXEJSSA-O |
| XLogP | -0.43 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|