C19H22BrN3O2 — CID 135895133
4-[(Z)-(4-benzylpiperazin-1-yl)iminomethyl]-2-bromo-6-methoxyphenol (PubChem CID 135895133) has the molecular formula C19H22BrN3O2 and a molecular weight of 404.31 g/mol. Its IUPAC name is 4-[(Z)-(4-benzylpiperazin-1-yl)iminomethyl]-2-bromo-6-methoxyphenol.
| Compound Name | 4-[(Z)-(4-benzylpiperazin-1-yl)iminomethyl]-2-bromo-6-methoxyphenol |
|---|---|
| PubChem CID | 135895133 |
| Molecular Formula | C19H22BrN3O2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 4-[(Z)-(4-benzylpiperazin-1-yl)iminomethyl]-2-bromo-6-methoxyphenol |
| SMILES | COc1cc(/C=N\N2CCN(Cc3ccccc3)CC2)cc(Br)c1O |
| InChI | InChI=1S/C19H22BrN3O2/c1-25-18-12-16(11-17(20)19(18)24)13-21-23-9-7-22(8-10-23)14-15-5-3-2-4-6-15/h2-6,11-13,24H,7-10,14H2,1H3/b21-13- |
| InChIKey | RCRKJWVWBSRZSP-BKUYFWCQSA-N |
| XLogP | 3.32 |
| TPSA | 48.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|