C18H19BrClN3O2 — CID 135676753
2-bromo-4-[[4-(4-chlorophenyl)piperazin-1-yl]iminomethyl]-6-methoxyphenol (PubChem CID 135676753) has the molecular formula C18H19BrClN3O2 and a molecular weight of 424.73 g/mol. Its IUPAC name is 2-bromo-4-[[4-(4-chlorophenyl)piperazin-1-yl]iminomethyl]-6-methoxyphenol.
| Compound Name | 2-bromo-4-[[4-(4-chlorophenyl)piperazin-1-yl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135676753 |
| Molecular Formula | C18H19BrClN3O2 |
| Molecular Weight | 424.73 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 2-bromo-4-[[4-(4-chlorophenyl)piperazin-1-yl]iminomethyl]-6-methoxyphenol |
| SMILES | COc1cc(C=NN2CCN(c3ccc(Cl)cc3)CC2)cc(Br)c1O |
| InChI | InChI=1S/C18H19BrClN3O2/c1-25-17-11-13(10-16(19)18(17)24)12-21-23-8-6-22(7-9-23)15-4-2-14(20)3-5-15/h2-5,10-12,24H,6-9H2,1H3 |
| InChIKey | IULBZUFEEOAOIC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 48.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.73 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|