C19H21BrClN3O — CID 1125280
1-(3-bromo-4-methoxyphenyl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine (PubChem CID 1125280) has the molecular formula C19H21BrClN3O and a molecular weight of 422.75 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine |
|---|---|
| PubChem CID | 1125280 |
| Molecular Formula | C19H21BrClN3O |
| Molecular Weight | 422.75 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine |
| SMILES | COc1ccc(C=NN2CCN(Cc3ccccc3Cl)CC2)cc1Br |
| InChI | InChI=1S/C19H21BrClN3O/c1-25-19-7-6-15(12-17(19)20)13-22-24-10-8-23(9-11-24)14-16-4-2-3-5-18(16)21/h2-7,12-13H,8-11,14H2,1H3 |
| InChIKey | OHNGBZZTEFSPSV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.75 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|