C16H17BrClN3S — CID 6886569
(E)-1-(5-bromothiophen-2-yl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine (PubChem CID 6886569) has the molecular formula C16H17BrClN3S and a molecular weight of 398.76 g/mol. Its IUPAC name is (E)-1-(5-bromothiophen-2-yl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine.
| Compound Name | (E)-1-(5-bromothiophen-2-yl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine |
|---|---|
| PubChem CID | 6886569 |
| Molecular Formula | C16H17BrClN3S |
| Molecular Weight | 398.76 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | (E)-1-(5-bromothiophen-2-yl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine |
| SMILES | Clc1ccccc1CN1CCN(/N=C/c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C16H17BrClN3S/c17-16-6-5-14(22-16)11-19-21-9-7-20(8-10-21)12-13-3-1-2-4-15(13)18/h1-6,11H,7-10,12H2/b19-11+ |
| InChIKey | JCUMWNRTXGLVBA-YBFXNURJSA-N |
| XLogP | 4.32 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.76 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|