C22H28ClN3 — CID 5342732
(E)-1-(4-tert-butylphenyl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine (PubChem CID 5342732) has the molecular formula C22H28ClN3 and a molecular weight of 369.94 g/mol. Its IUPAC name is (E)-1-(4-tert-butylphenyl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine.
| Compound Name | (E)-1-(4-tert-butylphenyl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine |
|---|---|
| PubChem CID | 5342732 |
| Molecular Formula | C22H28ClN3 |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | (E)-1-(4-tert-butylphenyl)-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]methanimine |
| SMILES | CC(C)(C)c1ccc(/C=N/N2CCN(Cc3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C22H28ClN3/c1-22(2,3)20-10-8-18(9-11-20)16-24-26-14-12-25(13-15-26)17-19-6-4-5-7-21(19)23/h4-11,16H,12-15,17H2,1-3H3/b24-16+ |
| InChIKey | WOBOQOBAWLSSHX-LFVJCYFKSA-N |
| XLogP | 4.79 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|