C23H22F3N3 — CID 2143797
N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-1-[4-(trifluoromethyl)phenyl]methanimine (PubChem CID 2143797) has the molecular formula C23H22F3N3 and a molecular weight of 397.44 g/mol. Its IUPAC name is N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-1-[4-(trifluoromethyl)phenyl]methanimine.
| Compound Name | N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-1-[4-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 2143797 |
| Molecular Formula | C23H22F3N3 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-1-[4-(trifluoromethyl)phenyl]methanimine |
| SMILES | FC(F)(F)c1ccc(C=NN2CCN(Cc3cccc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C23H22F3N3/c24-23(25,26)21-10-8-18(9-11-21)16-27-29-14-12-28(13-15-29)17-20-6-3-5-19-4-1-2-7-22(19)20/h1-11,16H,12-15,17H2 |
| InChIKey | OKGKQJOOJQIORW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|