C24H24BrN3 — CID 6899949
(E,E)-2-bromo-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-3-phenylprop-2-en-1-imine (PubChem CID 6899949) has the molecular formula C24H24BrN3 and a molecular weight of 434.38 g/mol. Its IUPAC name is (E,E)-2-bromo-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-3-phenylprop-2-en-1-imine.
| Compound Name | (E,E)-2-bromo-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 6899949 |
| Molecular Formula | C24H24BrN3 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | (E,E)-2-bromo-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-3-phenylprop-2-en-1-imine |
| SMILES | BrC(/C=N/N1CCN(Cc2cccc3ccccc23)CC1)=C/c1ccccc1 |
| InChI | InChI=1S/C24H24BrN3/c25-23(17-20-7-2-1-3-8-20)18-26-28-15-13-27(14-16-28)19-22-11-6-10-21-9-4-5-12-24(21)22/h1-12,17-18H,13-16,19H2/b23-17+,26-18+ |
| InChIKey | WEVQENAYLUVJHK-KWCUAYMTSA-N |
| XLogP | 5.38 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|