C14H18BrN3 — CID 5342562
(E,E)-2-bromo-N-(4-methylpiperazin-1-yl)-3-phenylprop-2-en-1-imine (PubChem CID 5342562) has the molecular formula C14H18BrN3 and a molecular weight of 308.22 g/mol. Its IUPAC name is (E,E)-2-bromo-N-(4-methylpiperazin-1-yl)-3-phenylprop-2-en-1-imine.
| Compound Name | (E,E)-2-bromo-N-(4-methylpiperazin-1-yl)-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 5342562 |
| Molecular Formula | C14H18BrN3 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | (E,E)-2-bromo-N-(4-methylpiperazin-1-yl)-3-phenylprop-2-en-1-imine |
| SMILES | CN1CCN(/N=C/C(Br)=C\c2ccccc2)CC1 |
| InChI | InChI=1S/C14H18BrN3/c1-17-7-9-18(10-8-17)16-12-14(15)11-13-5-3-2-4-6-13/h2-6,11-12H,7-10H2,1H3/b14-11+,16-12+ |
| InChIKey | SPGPVJVHLDSDDT-MHMBTURYSA-N |
| XLogP | 2.66 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|