C22H26BrN3 — CID 6900705
(E,Z)-2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine (PubChem CID 6900705) has the molecular formula C22H26BrN3 and a molecular weight of 412.38 g/mol. Its IUPAC name is (E,Z)-2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine.
| Compound Name | (E,Z)-2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 6900705 |
| Molecular Formula | C22H26BrN3 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (E,Z)-2-bromo-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-imine |
| SMILES | Cc1ccc(CN2CCN(/N=C/C(Br)=C/c3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H26BrN3/c1-18-8-9-21(19(2)14-18)17-25-10-12-26(13-11-25)24-16-22(23)15-20-6-4-3-5-7-20/h3-9,14-16H,10-13,17H2,1-2H3/b22-15-,24-16+ |
| InChIKey | JHCAOIGVSWSXLG-QEPGBLDRSA-N |
| XLogP | 4.84 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|