C20H25N3 — CID 5415240
(Z)-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-1-phenylmethanimine (PubChem CID 5415240) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is (Z)-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-1-phenylmethanimine.
| Compound Name | (Z)-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 5415240 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (Z)-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]-1-phenylmethanimine |
| SMILES | Cc1ccc(CN2CCN(/N=C\c3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H25N3/c1-17-8-9-20(18(2)14-17)16-22-10-12-23(13-11-22)21-15-19-6-4-3-5-7-19/h3-9,14-15H,10-13,16H2,1-2H3/b21-15- |
| InChIKey | PGAHVLXOZSYDAQ-QNGOZBTKSA-N |
| XLogP | 3.46 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|