C22H27N3O2 — CID 5435001
methyl 4-[(Z)-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]iminomethyl]benzoate (PubChem CID 5435001) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is methyl 4-[(Z)-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]iminomethyl]benzoate.
| Compound Name | methyl 4-[(Z)-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 5435001 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | methyl 4-[(Z)-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N\N2CCN(Cc3ccc(C)cc3C)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O2/c1-17-4-7-21(18(2)14-17)16-24-10-12-25(13-11-24)23-15-19-5-8-20(9-6-19)22(26)27-3/h4-9,14-15H,10-13,16H2,1-3H3/b23-15- |
| InChIKey | SNXKIOJYGMAVFF-HAHDFKILSA-N |
| XLogP | 3.24 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|