C24H34N4O — CID 135948699
5-(diethylamino)-2-[(Z)-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]iminomethyl]phenol (PubChem CID 135948699) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(Z)-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]iminomethyl]phenol.
| Compound Name | 5-(diethylamino)-2-[(Z)-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135948699 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 5-(diethylamino)-2-[(Z)-[4-[(2,4-dimethylphenyl)methyl]piperazin-1-yl]iminomethyl]phenol |
| SMILES | CCN(CC)c1ccc(/C=N\N2CCN(Cc3ccc(C)cc3C)CC2)c(O)c1 |
| InChI | InChI=1S/C24H34N4O/c1-5-27(6-2)23-10-9-21(24(29)16-23)17-25-28-13-11-26(12-14-28)18-22-8-7-19(3)15-20(22)4/h7-10,15-17,29H,5-6,11-14,18H2,1-4H3/b25-17- |
| InChIKey | JLSVESCSMSAXAB-UQQQWYQISA-N |
| XLogP | 4.01 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|