C20H26N2O — CID 830890
5-(diethylamino)-2-[(2,4,6-trimethylphenyl)iminomethyl]phenol (PubChem CID 830890) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(2,4,6-trimethylphenyl)iminomethyl]phenol.
| Compound Name | 5-(diethylamino)-2-[(2,4,6-trimethylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 830890 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 5-(diethylamino)-2-[(2,4,6-trimethylphenyl)iminomethyl]phenol |
| SMILES | CCN(CC)c1ccc(/C=N/c2c(C)cc(C)cc2C)c(O)c1 |
| InChI | InChI=1S/C20H26N2O/c1-6-22(7-2)18-9-8-17(19(23)12-18)13-21-20-15(4)10-14(3)11-16(20)5/h8-13,23H,6-7H2,1-5H3/b21-13+ |
| InChIKey | COMVRJADXMNKLR-FYJGNVAPSA-N |
| XLogP | 4.91 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|