C20H23N3OS — CID 135928970
5-(diethylamino)-2-[(E)-(5,6-dimethyl-1,3-benzothiazol-2-yl)iminomethyl]phenol (PubChem CID 135928970) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(E)-(5,6-dimethyl-1,3-benzothiazol-2-yl)iminomethyl]phenol.
| Compound Name | 5-(diethylamino)-2-[(E)-(5,6-dimethyl-1,3-benzothiazol-2-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135928970 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 5-(diethylamino)-2-[(E)-(5,6-dimethyl-1,3-benzothiazol-2-yl)iminomethyl]phenol |
| SMILES | CCN(CC)c1ccc(/C=N/c2nc3cc(C)c(C)cc3s2)c(O)c1 |
| InChI | InChI=1S/C20H23N3OS/c1-5-23(6-2)16-8-7-15(18(24)11-16)12-21-20-22-17-9-13(3)14(4)10-19(17)25-20/h7-12,24H,5-6H2,1-4H3/b21-12+ |
| InChIKey | QBSGSKBVQBLRNM-CIAFOILYSA-N |
| XLogP | 5.22 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|