C17H19Cl2N3O — CID 135675128
2-[(4-amino-3,5-dichlorophenyl)iminomethyl]-5-(diethylamino)phenol (PubChem CID 135675128) has the molecular formula C17H19Cl2N3O and a molecular weight of 352.27 g/mol. Its IUPAC name is 2-[(4-amino-3,5-dichlorophenyl)iminomethyl]-5-(diethylamino)phenol.
| Compound Name | 2-[(4-amino-3,5-dichlorophenyl)iminomethyl]-5-(diethylamino)phenol |
|---|---|
| PubChem CID | 135675128 |
| Molecular Formula | C17H19Cl2N3O |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-[(4-amino-3,5-dichlorophenyl)iminomethyl]-5-(diethylamino)phenol |
| SMILES | CCN(CC)c1ccc(/C=N/c2cc(Cl)c(N)c(Cl)c2)c(O)c1 |
| InChI | InChI=1S/C17H19Cl2N3O/c1-3-22(4-2)13-6-5-11(16(23)9-13)10-21-12-7-14(18)17(20)15(19)8-12/h5-10,23H,3-4,20H2,1-2H3/b21-10+ |
| InChIKey | IRWIBZFPJSJKPN-UFFVCSGVSA-N |
| XLogP | 4.88 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|