C25H26N6S — CID 168747254
4-[[4-[(5,6-dimethyl-1,3-benzothiazol-2-yl)diazenyl]phenyl]diazenyl]-N,N-diethylaniline (PubChem CID 168747254) has the molecular formula C25H26N6S and a molecular weight of 442.59 g/mol. Its IUPAC name is 4-[[4-[(5,6-dimethyl-1,3-benzothiazol-2-yl)diazenyl]phenyl]diazenyl]-N,N-diethylaniline.
| Compound Name | 4-[[4-[(5,6-dimethyl-1,3-benzothiazol-2-yl)diazenyl]phenyl]diazenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 168747254 |
| Molecular Formula | C25H26N6S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 4-[[4-[(5,6-dimethyl-1,3-benzothiazol-2-yl)diazenyl]phenyl]diazenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(/N=N/c3nc4cc(C)c(C)cc4s3)cc2)cc1 |
| InChI | InChI=1S/C25H26N6S/c1-5-31(6-2)22-13-11-21(12-14-22)28-27-19-7-9-20(10-8-19)29-30-25-26-23-15-17(3)18(4)16-24(23)32-25/h7-16H,5-6H2,1-4H3/b28-27+,30-29+ |
| InChIKey | UMVDNPTWFIJLHS-XOXGWFOHSA-N |
| XLogP | 8.59 |
| TPSA | 65.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|