C16H16N4S — CID 163643929
4-(1,3-benzothiazol-2-yldiazenyl)-N-ethyl-N-methylaniline (PubChem CID 163643929) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yldiazenyl)-N-ethyl-N-methylaniline.
| Compound Name | 4-(1,3-benzothiazol-2-yldiazenyl)-N-ethyl-N-methylaniline |
|---|---|
| PubChem CID | 163643929 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yldiazenyl)-N-ethyl-N-methylaniline |
| SMILES | CCN(C)c1ccc(/N=N/c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H16N4S/c1-3-20(2)13-10-8-12(9-11-13)18-19-16-17-14-6-4-5-7-15(14)21-16/h4-11H,3H2,1-2H3/b19-18+ |
| InChIKey | IGQIYAMRZAQIEL-VHEBQXMUSA-N |
| XLogP | 5.17 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|