C26H28N6O2S — CID 89191975
[5-(dipropylamino)-2-[(6-phenyldiazenyl-1,3-benzothiazol-2-yl)diazenyl]phenyl]methanediol (PubChem CID 89191975) has the molecular formula C26H28N6O2S and a molecular weight of 488.62 g/mol. Its IUPAC name is [5-(dipropylamino)-2-[(6-phenyldiazenyl-1,3-benzothiazol-2-yl)diazenyl]phenyl]methanediol.
| Compound Name | [5-(dipropylamino)-2-[(6-phenyldiazenyl-1,3-benzothiazol-2-yl)diazenyl]phenyl]methanediol |
|---|---|
| PubChem CID | 89191975 |
| Molecular Formula | C26H28N6O2S |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | [5-(dipropylamino)-2-[(6-phenyldiazenyl-1,3-benzothiazol-2-yl)diazenyl]phenyl]methanediol |
| SMILES | CCCN(CCC)c1ccc(/N=N/c2nc3ccc(/N=N/c4ccccc4)cc3s2)c(C(O)O)c1 |
| InChI | InChI=1S/C26H28N6O2S/c1-3-14-32(15-4-2)20-11-13-22(21(17-20)25(33)34)30-31-26-27-23-12-10-19(16-24(23)35-26)29-28-18-8-6-5-7-9-18/h5-13,16-17,25,33-34H,3-4,14-15H2,1-2H3/b29-28+,31-30+ |
| InChIKey | KITIJXZHOPOSIV-DUJDKOHPSA-N |
| XLogP | 7.74 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|