C19H18N4O4S — CID 102122000
5-[carboxymethyl(ethyl)amino]-2-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]benzoic acid (PubChem CID 102122000) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is 5-[carboxymethyl(ethyl)amino]-2-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]benzoic acid.
| Compound Name | 5-[carboxymethyl(ethyl)amino]-2-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 102122000 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 5-[carboxymethyl(ethyl)amino]-2-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]benzoic acid |
| SMILES | CCN(CC(=O)O)c1ccc(/N=N/c2nc3ccc(C)cc3s2)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H18N4O4S/c1-3-23(10-17(24)25)12-5-7-14(13(9-12)18(26)27)21-22-19-20-15-6-4-11(2)8-16(15)28-19/h4-9H,3,10H2,1-2H3,(H,24,25)(H,26,27)/b22-21+ |
| InChIKey | CZVZMCRZIYPBRO-QURGRASLSA-N |
| XLogP | 4.63 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|