C16H21N5O2S — CID 20654690
5-[di(propan-2-yl)amino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)diazenyl]benzoic acid (PubChem CID 20654690) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 5-[di(propan-2-yl)amino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)diazenyl]benzoic acid.
| Compound Name | 5-[di(propan-2-yl)amino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 20654690 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 5-[di(propan-2-yl)amino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)diazenyl]benzoic acid |
| SMILES | Cc1nnc(/N=N/c2ccc(N(C(C)C)C(C)C)cc2C(=O)O)s1 |
| InChI | InChI=1S/C16H21N5O2S/c1-9(2)21(10(3)4)12-6-7-14(13(8-12)15(22)23)18-20-16-19-17-11(5)24-16/h6-10H,1-5H3,(H,22,23)/b20-18+ |
| InChIKey | ZBDVPKGMKOIVNL-CZIZESTLSA-N |
| XLogP | 4.58 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|