C20H23Br2N3O2 — CID 94843995
2-[[4-[[(2R)-2-bromopropyl]-[(2S)-2-bromopropyl]amino]-2-methylphenyl]diazenyl]benzoic acid (PubChem CID 94843995) has the molecular formula C20H23Br2N3O2 and a molecular weight of 497.23 g/mol. Its IUPAC name is 2-[[4-[[(2R)-2-bromopropyl]-[(2S)-2-bromopropyl]amino]-2-methylphenyl]diazenyl]benzoic acid.
| Compound Name | 2-[[4-[[(2R)-2-bromopropyl]-[(2S)-2-bromopropyl]amino]-2-methylphenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 94843995 |
| Molecular Formula | C20H23Br2N3O2 |
| Molecular Weight | 497.23 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | 2-[[4-[[(2R)-2-bromopropyl]-[(2S)-2-bromopropyl]amino]-2-methylphenyl]diazenyl]benzoic acid |
| SMILES | Cc1cc(N(C[C@H](C)Br)C[C@@H](C)Br)ccc1/N=N/c1ccccc1C(=O)O |
| InChI | InChI=1S/C20H23Br2N3O2/c1-13-10-16(25(11-14(2)21)12-15(3)22)8-9-18(13)23-24-19-7-5-4-6-17(19)20(26)27/h4-10,14-15H,11-12H2,1-3H3,(H,26,27)/b24-23+/t14-,15+ |
| InChIKey | IUBPTOPNFAZJQA-UXRJGGBKSA-N |
| XLogP | 6.48 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.23 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|