C17H19IN3O2- — CID 20831759
2-[[4-(diethylamino)phenyl]diazenyl]benzoic acid iodide (PubChem CID 20831759) has the molecular formula C17H19IN3O2- and a molecular weight of 424.26 g/mol. Its IUPAC name is 2-[[4-(diethylamino)phenyl]diazenyl]benzoic acid iodide.
| Compound Name | 2-[[4-(diethylamino)phenyl]diazenyl]benzoic acid iodide |
|---|---|
| PubChem CID | 20831759 |
| Molecular Formula | C17H19IN3O2- |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 2-[[4-(diethylamino)phenyl]diazenyl]benzoic acid iodide |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccccc2C(=O)O)cc1.[I-] |
| InChI | InChI=1S/C17H19N3O2.HI/c1-3-20(4-2)14-11-9-13(10-12-14)18-19-16-8-6-5-7-15(16)17(21)22;/h5-12H,3-4H2,1-2H3,(H,21,22);1H/p-1/b19-18+; |
| InChIKey | UQONODQYGDMLLY-LTRPLHCISA-M |
| XLogP | 1.65 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|