About 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol
4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol (PubChem CID 159605482) has the molecular formula C38H32N4O5
and a molecular weight of 624.70 g/mol. Its IUPAC name is 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol.
Molecular Properties
| Compound Name | 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol |
| PubChem CID | 159605482 |
| Molecular Formula | C38H32N4O5 |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol |
| SMILES | O=C(O)c1ccccc1/N=N/c1ccc(O)cc1.Oc1ccc(/N=N/c2ccccc2)cc1.Oc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H10N2O3.C13H12O.C12H10N2O/c16-10-7-5-9(6-8-10)14-15-12-4-2-1-3-11(12)13(17)18;14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11;15-12-8-6-11(7-9-12)14-13-10-4-2-1-3-5-10/h1-8,16H,(H,17,18);1-9,14H,10H2;1-9,15H/b15-14+;;14-13+ |
| InChIKey | MMAKDJNCVFKGNR-FASBXLLLSA-N |
| XLogP | 10.30 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol?
The IUPAC name of 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol (CID 159605482) is 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol.
What is the SMILES notation for 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol?
The canonical SMILES for 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol is O=C(O)c1ccccc1/N=N/c1ccc(O)cc1.Oc1ccc(/N=N/c2ccccc2)cc1.Oc1ccc(Cc2ccccc2)cc1.
What is the InChIKey of 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol?
The InChIKey is MMAKDJNCVFKGNR-FASBXLLLSA-N. The full InChI is InChI=1S/C13H10N2O3.C13H12O.C12H10N2O/c16-10-7-5-9(6-8-10)14-15-12-4-2-1-3-11(12)13(17)18;14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11;15-12-8-6-11(7-9-12)14-13-10-4-2-1-3-5-10/h1-8,16H,(H,17,18);1-9,14H,10H2;1-9,15H/b15-14+;;14-13+.
What are the key properties of 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol?
4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol has a molecular weight of 624.70 g/mol, XLogP of 10.30, 7 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylphenol;2-[(4-hydroxyphenyl)diazenyl]benzoic acid;4-phenyldiazenylphenol is sourced from PubChem (CID 159605482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).