C22H16N4O4 — CID 135774565
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-[(4-hydroxyphenyl)diazenyl]benzoate (PubChem CID 135774565) has the molecular formula C22H16N4O4 and a molecular weight of 400.39 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-[(4-hydroxyphenyl)diazenyl]benzoate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-[(4-hydroxyphenyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 135774565 |
| Molecular Formula | C22H16N4O4 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-[(4-hydroxyphenyl)diazenyl]benzoate |
| SMILES | O=C(OCc1nnc(-c2ccccc2)o1)c1ccccc1/N=N/c1ccc(O)cc1 |
| InChI | InChI=1S/C22H16N4O4/c27-17-12-10-16(11-13-17)23-24-19-9-5-4-8-18(19)22(28)29-14-20-25-26-21(30-20)15-6-2-1-3-7-15/h1-13,27H,14H2/b24-23+ |
| InChIKey | NABOYBHNOLJKBJ-WCWDXBQESA-N |
| XLogP | 5.21 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|