C15H15N3O2 — CID 173282434
N-ethyl-2-[(4-hydroxyphenyl)diazenyl]benzamide (PubChem CID 173282434) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-ethyl-2-[(4-hydroxyphenyl)diazenyl]benzamide.
| Compound Name | N-ethyl-2-[(4-hydroxyphenyl)diazenyl]benzamide |
|---|---|
| PubChem CID | 173282434 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-ethyl-2-[(4-hydroxyphenyl)diazenyl]benzamide |
| SMILES | CCNC(=O)c1ccccc1/N=N/c1ccc(O)cc1 |
| InChI | InChI=1S/C15H15N3O2/c1-2-16-15(20)13-5-3-4-6-14(13)18-17-11-7-9-12(19)10-8-11/h3-10,19H,2H2,1H3,(H,16,20)/b18-17+ |
| InChIKey | AIZBZOIOJQKGBS-ISLYRVAYSA-N |
| XLogP | 3.56 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|