C24H23N3O4S — CID 135558281
[2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-[(4-hydroxyphenyl)diazenyl]benzoate (PubChem CID 135558281) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-[(4-hydroxyphenyl)diazenyl]benzoate.
| Compound Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-[(4-hydroxyphenyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 135558281 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-[(4-hydroxyphenyl)diazenyl]benzoate |
| SMILES | Cc1ccc(SCCNC(=O)COC(=O)c2ccccc2/N=N/c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O4S/c1-17-6-12-20(13-7-17)32-15-14-25-23(29)16-31-24(30)21-4-2-3-5-22(21)27-26-18-8-10-19(28)11-9-18/h2-13,28H,14-16H2,1H3,(H,25,29)/b27-26+ |
| InChIKey | JNZVAIFGZOJJKD-CYYJNZCTSA-N |
| XLogP | 5.18 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|