C21H24N2O5S — CID 7629041
[2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-[(2-methoxybenzoyl)amino]acetate (PubChem CID 7629041) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-[(2-methoxybenzoyl)amino]acetate.
| Compound Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-[(2-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7629041 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-[(2-methoxybenzoyl)amino]acetate |
| SMILES | COc1ccccc1C(=O)NCC(=O)OCC(=O)NCCSc1ccc(C)cc1 |
| InChI | InChI=1S/C21H24N2O5S/c1-15-7-9-16(10-8-15)29-12-11-22-19(24)14-28-20(25)13-23-21(26)17-5-3-4-6-18(17)27-2/h3-10H,11-14H2,1-2H3,(H,22,24)(H,23,26) |
| InChIKey | CPBHIVHWHLPRRZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|