C24H23N3O4 — CID 135677830
[2-(2-ethyl-6-methylanilino)-2-oxoethyl] 2-[(4-hydroxyphenyl)diazenyl]benzoate (PubChem CID 135677830) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 2-[(4-hydroxyphenyl)diazenyl]benzoate.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 2-[(4-hydroxyphenyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 135677830 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 2-[(4-hydroxyphenyl)diazenyl]benzoate |
| SMILES | CCc1cccc(C)c1NC(=O)COC(=O)c1ccccc1/N=N/c1ccc(O)cc1 |
| InChI | InChI=1S/C24H23N3O4/c1-3-17-8-6-7-16(2)23(17)25-22(29)15-31-24(30)20-9-4-5-10-21(20)27-26-18-11-13-19(28)14-12-18/h4-14,28H,3,15H2,1-2H3,(H,25,29)/b27-26+ |
| InChIKey | LBHOMZPHSAQDRK-CYYJNZCTSA-N |
| XLogP | 5.47 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|