C18H18N4O4 — CID 91094447
2-[[4-[cyanomethyl(ethyl)amino]phenyl]diazenyl]-4-(dihydroxymethyl)benzoic acid (PubChem CID 91094447) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-[[4-[cyanomethyl(ethyl)amino]phenyl]diazenyl]-4-(dihydroxymethyl)benzoic acid.
| Compound Name | 2-[[4-[cyanomethyl(ethyl)amino]phenyl]diazenyl]-4-(dihydroxymethyl)benzoic acid |
|---|---|
| PubChem CID | 91094447 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-[[4-[cyanomethyl(ethyl)amino]phenyl]diazenyl]-4-(dihydroxymethyl)benzoic acid |
| SMILES | CCN(CC#N)c1ccc(/N=N/c2cc(C(O)O)ccc2C(=O)O)cc1 |
| InChI | InChI=1S/C18H18N4O4/c1-2-22(10-9-19)14-6-4-13(5-7-14)20-21-16-11-12(17(23)24)3-8-15(16)18(25)26/h3-8,11,17,23-24H,2,10H2,1H3,(H,25,26)/b21-20+ |
| InChIKey | ZDNCTEAMDIIRRO-QZQOTICOSA-N |
| XLogP | 3.13 |
| TPSA | 129.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|