C60H54N12O6 — CID 102471911
tris[2-[4-[(4-cyanophenyl)diazenyl]-N-ethylanilino]ethyl] benzene-1,3,5-tricarboxylate (PubChem CID 102471911) has the molecular formula C60H54N12O6 and a molecular weight of 1039.17 g/mol. Its IUPAC name is tris[2-[4-[(4-cyanophenyl)diazenyl]-N-ethylanilino]ethyl] benzene-1,3,5-tricarboxylate.
| Compound Name | tris[2-[4-[(4-cyanophenyl)diazenyl]-N-ethylanilino]ethyl] benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 102471911 |
| Molecular Formula | C60H54N12O6 |
| Molecular Weight | 1039.17 g/mol |
| Exact Mass | 1038.43 |
| IUPAC Name | tris[2-[4-[(4-cyanophenyl)diazenyl]-N-ethylanilino]ethyl] benzene-1,3,5-tricarboxylate |
| SMILES | CCN(CCOC(=O)c1cc(C(=O)OCCN(CC)c2ccc(/N=N/c3ccc(C#N)cc3)cc2)cc(C(=O)OCCN(CC)c2ccc(/N=N/c3ccc(C#N)cc3)cc2)c1)c1ccc(/N=N/c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C60H54N12O6/c1-4-70(55-25-19-52(20-26-55)67-64-49-13-7-43(40-61)8-14-49)31-34-76-58(73)46-37-47(59(74)77-35-32-71(5-2)56-27-21-53(22-28-56)68-65-50-15-9-44(41-62)10-16-50)39-48(38-46)60(75)78-36-33-72(6-3)57-29-23-54(24-30-57)69-66-51-17-11-45(42-63)12-18-51/h7-30,37-39H,4-6,31-36H2,1-3H3/b67-64+,68-65+,69-66+ |
| InChIKey | BVQIJDGKJVMXGF-DNQNZXESSA-N |
| XLogP | 13.60 |
| TPSA | 234.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1039.17 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|