C21H25N6O2+ — CID 20841800
2-[4-[(1,1-dimethyl-1,2,4-triazol-1-ium-3-yl)diazenyl]-N-ethylanilino]ethyl benzoate (PubChem CID 20841800) has the molecular formula C21H25N6O2+ and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-[4-[(1,1-dimethyl-1,2,4-triazol-1-ium-3-yl)diazenyl]-N-ethylanilino]ethyl benzoate.
| Compound Name | 2-[4-[(1,1-dimethyl-1,2,4-triazol-1-ium-3-yl)diazenyl]-N-ethylanilino]ethyl benzoate |
|---|---|
| PubChem CID | 20841800 |
| Molecular Formula | C21H25N6O2+ |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-[4-[(1,1-dimethyl-1,2,4-triazol-1-ium-3-yl)diazenyl]-N-ethylanilino]ethyl benzoate |
| SMILES | CCN(CCOC(=O)c1ccccc1)c1ccc(/N=N/C2=N[N+](C)(C)C=N2)cc1 |
| InChI | InChI=1S/C21H25N6O2/c1-4-26(14-15-29-20(28)17-8-6-5-7-9-17)19-12-10-18(11-13-19)23-24-21-22-16-27(2,3)25-21/h5-13,16H,4,14-15H2,1-3H3/q+1/b24-23+ |
| InChIKey | DCPZXCTUCGSCJK-WCWDXBQESA-N |
| XLogP | 3.84 |
| TPSA | 78.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|