C19H20N4O3 — CID 87412965
2-[N-ethyl-4-[(4-nitrosophenyl)diazenyl]anilino]ethyl prop-2-enoate (PubChem CID 87412965) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[N-ethyl-4-[(4-nitrosophenyl)diazenyl]anilino]ethyl prop-2-enoate.
| Compound Name | 2-[N-ethyl-4-[(4-nitrosophenyl)diazenyl]anilino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 87412965 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[N-ethyl-4-[(4-nitrosophenyl)diazenyl]anilino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(CC)c1ccc(/N=N/c2ccc(N=O)cc2)cc1 |
| InChI | InChI=1S/C19H20N4O3/c1-3-19(24)26-14-13-23(4-2)18-11-9-16(10-12-18)21-20-15-5-7-17(22-25)8-6-15/h3,5-12H,1,4,13-14H2,2H3/b21-20+ |
| InChIKey | QFBHPRHWMFKKEK-QZQOTICOSA-N |
| XLogP | 5.06 |
| TPSA | 83.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|