C30H31F2N5O4 — CID 161427329
2-[4-[[4-[[2,3-difluoro-4-(3-oxopentoxy)phenyl]diazenyl]phenyl]diazenyl]-N-ethylanilino]ethyl prop-2-enoate (PubChem CID 161427329) has the molecular formula C30H31F2N5O4 and a molecular weight of 563.61 g/mol. Its IUPAC name is 2-[4-[[4-[[2,3-difluoro-4-(3-oxopentoxy)phenyl]diazenyl]phenyl]diazenyl]-N-ethylanilino]ethyl prop-2-enoate.
| Compound Name | 2-[4-[[4-[[2,3-difluoro-4-(3-oxopentoxy)phenyl]diazenyl]phenyl]diazenyl]-N-ethylanilino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 161427329 |
| Molecular Formula | C30H31F2N5O4 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 2-[4-[[4-[[2,3-difluoro-4-(3-oxopentoxy)phenyl]diazenyl]phenyl]diazenyl]-N-ethylanilino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(CC)c1ccc(/N=N/c2ccc(/N=N/c3ccc(OCCC(=O)CC)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C30H31F2N5O4/c1-4-25(38)17-19-40-27-16-15-26(29(31)30(27)32)36-35-22-9-7-21(8-10-22)33-34-23-11-13-24(14-12-23)37(6-3)18-20-41-28(39)5-2/h5,7-16H,2,4,6,17-20H2,1,3H3/b34-33+,36-35+ |
| InChIKey | VIUZVTRINSZJHJ-WXBFSDFVSA-N |
| XLogP | 8.10 |
| TPSA | 105.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|