C36H46N6O5 — CID 156628746
9-[[6-[[2-methyl-4-[[4-[methyl(2-prop-2-enoyloxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]-3-pyridinyl]oxy]nonyl propanoate (PubChem CID 156628746) has the molecular formula C36H46N6O5 and a molecular weight of 642.80 g/mol. Its IUPAC name is 9-[[6-[[2-methyl-4-[[4-[methyl(2-prop-2-enoyloxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]-3-pyridinyl]oxy]nonyl propanoate.
| Compound Name | 9-[[6-[[2-methyl-4-[[4-[methyl(2-prop-2-enoyloxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]-3-pyridinyl]oxy]nonyl propanoate |
|---|---|
| PubChem CID | 156628746 |
| Molecular Formula | C36H46N6O5 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.35 |
| IUPAC Name | 9-[[6-[[2-methyl-4-[[4-[methyl(2-prop-2-enoyloxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]-3-pyridinyl]oxy]nonyl propanoate |
| SMILES | C=CC(=O)OCCN(C)c1ccc(/N=N/c2ccc(/N=N/c3ccc(OCCCCCCCCCOC(=O)CC)cn3)c(C)c2)cc1 |
| InChI | InChI=1S/C36H46N6O5/c1-5-35(43)46-24-13-11-9-7-8-10-12-23-45-32-19-21-34(37-27-32)41-40-33-20-16-30(26-28(33)3)39-38-29-14-17-31(18-15-29)42(4)22-25-47-36(44)6-2/h6,14-21,26-27H,2,5,7-13,22-25H2,1,3-4H3/b39-38+,41-40+ |
| InChIKey | WOKGFZLNIJRFQI-VJETXLNASA-N |
| XLogP | 9.45 |
| TPSA | 127.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|