C48H48N6O8 — CID 155624241
[4-[4-[[4-[methyl(4-prop-2-enoyloxybutyl)amino]phenyl]diazenyl]benzoyl]oxyphenyl] 4-[[4-[methyl(4-prop-2-enoyloxybutyl)amino]phenyl]diazenyl]benzoate (PubChem CID 155624241) has the molecular formula C48H48N6O8 and a molecular weight of 836.95 g/mol. Its IUPAC name is [4-[4-[[4-[methyl(4-prop-2-enoyloxybutyl)amino]phenyl]diazenyl]benzoyl]oxyphenyl] 4-[[4-[methyl(4-prop-2-enoyloxybutyl)amino]phenyl]diazenyl]benzoate.
| Compound Name | [4-[4-[[4-[methyl(4-prop-2-enoyloxybutyl)amino]phenyl]diazenyl]benzoyl]oxyphenyl] 4-[[4-[methyl(4-prop-2-enoyloxybutyl)amino]phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 155624241 |
| Molecular Formula | C48H48N6O8 |
| Molecular Weight | 836.95 g/mol |
| Exact Mass | 836.35 |
| IUPAC Name | [4-[4-[[4-[methyl(4-prop-2-enoyloxybutyl)amino]phenyl]diazenyl]benzoyl]oxyphenyl] 4-[[4-[methyl(4-prop-2-enoyloxybutyl)amino]phenyl]diazenyl]benzoate |
| SMILES | C=CC(=O)OCCCCN(C)c1ccc(/N=N/c2ccc(C(=O)Oc3ccc(OC(=O)c4ccc(/N=N/c5ccc(N(C)CCCCOC(=O)C=C)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H48N6O8/c1-5-45(55)59-33-9-7-31-53(3)41-23-19-39(20-24-41)51-49-37-15-11-35(12-16-37)47(57)61-43-27-29-44(30-28-43)62-48(58)36-13-17-38(18-14-36)50-52-40-21-25-42(26-22-40)54(4)32-8-10-34-60-46(56)6-2/h5-6,11-30H,1-2,7-10,31-34H2,3-4H3/b51-49+,52-50+ |
| InChIKey | LWMGYTXJVTYSEX-BILXIUEVSA-N |
| XLogP | 10.85 |
| TPSA | 161.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.95 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|