C37H38FN7O4 — CID 164843008
[4-[[4-[[2-fluoro-4-[[4-[methyl(2-prop-2-enoyloxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenyl] heptanoate (PubChem CID 164843008) has the molecular formula C37H38FN7O4 and a molecular weight of 663.75 g/mol. Its IUPAC name is [4-[[4-[[2-fluoro-4-[[4-[methyl(2-prop-2-enoyloxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenyl] heptanoate.
| Compound Name | [4-[[4-[[2-fluoro-4-[[4-[methyl(2-prop-2-enoyloxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenyl] heptanoate |
|---|---|
| PubChem CID | 164843008 |
| Molecular Formula | C37H38FN7O4 |
| Molecular Weight | 663.75 g/mol |
| Exact Mass | 663.30 |
| IUPAC Name | [4-[[4-[[2-fluoro-4-[[4-[methyl(2-prop-2-enoyloxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenyl] heptanoate |
| SMILES | C=CC(=O)OCCN(C)c1ccc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4ccc(OC(=O)CCCCCC)cc4)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C37H38FN7O4/c1-4-6-7-8-9-37(47)49-33-21-16-30(17-22-33)40-39-27-10-12-28(13-11-27)42-44-35-23-18-31(26-34(35)38)43-41-29-14-19-32(20-15-29)45(3)24-25-48-36(46)5-2/h5,10-23,26H,2,4,6-9,24-25H2,1,3H3/b40-39+,43-41+,44-42+ |
| InChIKey | WLQKYPPMTNXYDY-AGPYNHEDSA-N |
| XLogP | 11.11 |
| TPSA | 130.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.75 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|