C50H59N7O6 — CID 89449535
8-[N-(8-hydroxy-9-oxoundec-10-enyl)-4-[[3-methyl-4-[[4-[(4-prop-2-enoyloxyphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]anilino]octyl prop-2-enoate (PubChem CID 89449535) has the molecular formula C50H59N7O6 and a molecular weight of 854.07 g/mol. Its IUPAC name is 8-[N-(8-hydroxy-9-oxoundec-10-enyl)-4-[[3-methyl-4-[[4-[(4-prop-2-enoyloxyphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]anilino]octyl prop-2-enoate.
| Compound Name | 8-[N-(8-hydroxy-9-oxoundec-10-enyl)-4-[[3-methyl-4-[[4-[(4-prop-2-enoyloxyphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]anilino]octyl prop-2-enoate |
|---|---|
| PubChem CID | 89449535 |
| Molecular Formula | C50H59N7O6 |
| Molecular Weight | 854.07 g/mol |
| Exact Mass | 853.45 |
| IUPAC Name | 8-[N-(8-hydroxy-9-oxoundec-10-enyl)-4-[[3-methyl-4-[[4-[(4-prop-2-enoyloxyphenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]anilino]octyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCN(CCCCCCCC(O)C(=O)C=C)c1ccc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4ccc(OC(=O)C=C)cc4)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C50H59N7O6/c1-5-47(58)48(59)19-15-11-10-13-17-35-57(34-16-12-8-9-14-18-36-62-49(60)6-2)44-29-24-41(25-30-44)53-55-43-28-33-46(38(4)37-43)56-54-40-22-20-39(21-23-40)51-52-42-26-31-45(32-27-42)63-50(61)7-3/h5-7,20-33,37,48,59H,1-3,8-19,34-36H2,4H3/b52-51+,55-53+,56-54+ |
| InChIKey | WGAKVEPCNODYDN-FKQBXBTDSA-N |
| XLogP | 13.67 |
| TPSA | 167.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.07 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|