C41H48N6O6 — CID 167376064
5-[4-[[4-[[2-methyl-4-[[4-(5-propanoyloxypentoxy)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenoxy]pentyl propanoate (PubChem CID 167376064) has the molecular formula C41H48N6O6 and a molecular weight of 720.87 g/mol. Its IUPAC name is 5-[4-[[4-[[2-methyl-4-[[4-(5-propanoyloxypentoxy)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenoxy]pentyl propanoate.
| Compound Name | 5-[4-[[4-[[2-methyl-4-[[4-(5-propanoyloxypentoxy)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenoxy]pentyl propanoate |
|---|---|
| PubChem CID | 167376064 |
| Molecular Formula | C41H48N6O6 |
| Molecular Weight | 720.87 g/mol |
| Exact Mass | 720.36 |
| IUPAC Name | 5-[4-[[4-[[2-methyl-4-[[4-(5-propanoyloxypentoxy)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenoxy]pentyl propanoate |
| SMILES | CCC(=O)OCCCCCOc1ccc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4ccc(OCCCCCOC(=O)CC)cc4)cc3C)cc2)cc1 |
| InChI | InChI=1S/C41H48N6O6/c1-4-40(48)52-28-10-6-8-26-50-37-21-16-34(17-22-37)43-42-32-12-14-33(15-13-32)45-47-39-25-20-36(30-31(39)3)46-44-35-18-23-38(24-19-35)51-27-9-7-11-29-53-41(49)5-2/h12-25,30H,4-11,26-29H2,1-3H3/b43-42+,46-44+,47-45+ |
| InChIKey | GRYIXATYPBCQQC-NLZFBVBESA-N |
| XLogP | 12.25 |
| TPSA | 145.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.87 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|