C36H47N5O5 — CID 174198662
7-[4-[[4-[[4-[ethyl(2-propanoyloxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]phenoxy]heptyl butanoate (PubChem CID 174198662) has the molecular formula C36H47N5O5 and a molecular weight of 629.80 g/mol. Its IUPAC name is 7-[4-[[4-[[4-[ethyl(2-propanoyloxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]phenoxy]heptyl butanoate.
| Compound Name | 7-[4-[[4-[[4-[ethyl(2-propanoyloxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]phenoxy]heptyl butanoate |
|---|---|
| PubChem CID | 174198662 |
| Molecular Formula | C36H47N5O5 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.36 |
| IUPAC Name | 7-[4-[[4-[[4-[ethyl(2-propanoyloxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]phenoxy]heptyl butanoate |
| SMILES | CCCC(=O)OCCCCCCCOc1ccc(/N=N/c2ccc(/N=N/c3ccc(N(CC)CCOC(=O)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H47N5O5/c1-4-12-36(43)45-27-11-9-7-8-10-26-44-34-23-19-32(20-24-34)40-38-30-15-13-29(14-16-30)37-39-31-17-21-33(22-18-31)41(6-3)25-28-46-35(42)5-2/h13-24H,4-12,25-28H2,1-3H3/b39-37+,40-38+ |
| InChIKey | MVBIRWRBFVZTER-HVMBLDELSA-N |
| XLogP | 9.97 |
| TPSA | 114.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|